CAS 2225940-49-6 appears in our catalog under these names: Pomalidomide 4'–alkylC5–acid, Pomalidomide 4'-alkylC5-acid 98%, Pomalidomide 4'-alkylC5-acid, 98%, 98%, Pomalidomide 4'-alkylC5-acid, 98.78%, Pomalidomide 4'-alkylC5-acid, 98%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 25mg, 50mg, 250mg, 1g, 5g, 1 g, 250 mg.
6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoic acid (CAS 2225940-49-6) is a chemical compound with the molecular formula C19H21N3O6 and a molecular weight of 387.4 g/mol. IUPAC name: 6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoic acid. InChIKey: FOHDGJCYBZWKCE-UHFFFAOYSA-N.
| Molecular formula | C19H21N3O6 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | 6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoic acid |
| InChIKey | FOHDGJCYBZWKCE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)NCCCCCC(=O)O |
Computed by PubChem (NCBI)