CAS 222608-06-2 is the registry number for Denatonium Hydroxide. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 100mg, 250mg, 500mg, 5000mg, 1000mg.
Benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium hydroxide (CAS 222608-06-2) is a chemical compound with the molecular formula C21H30N2O2 and a molecular weight of 342.5 g/mol. IUPAC name: benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium hydroxide. InChIKey: XJUUDTMUUDAAPP-UHFFFAOYSA-N.
| Molecular formula | C21H30N2O2 |
|---|---|
| Molecular weight | 342.5 g/mol |
| IUPAC name | benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium hydroxide |
| InChIKey | XJUUDTMUUDAAPP-UHFFFAOYSA-N |
| SMILES | CC[N+](CC)(CC1=CC=CC=C1)CC(=O)NC2=C(C=CC=C2C)C.[OH-] |
Computed by PubChem (NCBI)