Products 222608-06-2

CAS 222608-06-2 is the registry number for Denatonium Hydroxide. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 100mg, 250mg, 500mg, 5000mg, 1000mg.

Structural formula: {0} (CAS {1})

Benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium hydroxide (CAS 222608-06-2) is a chemical compound with the molecular formula C21H30N2O2 and a molecular weight of 342.5 g/mol. IUPAC name: benzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium hydroxide. InChIKey: XJUUDTMUUDAAPP-UHFFFAOYSA-N.

Identity
Molecular formulaC21H30N2O2
Molecular weight342.5 g/mol
IUPAC namebenzyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-diethylazanium hydroxide
InChIKeyXJUUDTMUUDAAPP-UHFFFAOYSA-N
SMILESCC[N+](CC)(CC1=CC=CC=C1)CC(=O)NC2=C(C=CC=C2C)C.[OH-]

Computed by PubChem (NCBI)