Products 2226087-09-6

CAS 2226087-09-6 is the registry number for 2-(2-Hydroxyethylamino)pyrimidine-5-boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

[2-(2-hydroxyethylamino)pyrimidin-5-yl]boronic acid (CAS 2226087-09-6) is a chemical compound with the molecular formula C6H10BN3O3 and a molecular weight of 182.98 g/mol. IUPAC name: [2-(2-hydroxyethylamino)pyrimidin-5-yl]boronic acid. InChIKey: NSOJWRUCXXCYMN-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10BN3O3
Molecular weight182.98 g/mol
IUPAC name[2-(2-hydroxyethylamino)pyrimidin-5-yl]boronic acid
InChIKeyNSOJWRUCXXCYMN-UHFFFAOYSA-N
SMILESB(C1=CN=C(N=C1)NCCO)(O)O

Computed by PubChem (NCBI)