CAS 22261-57-0 is the registry number for 6,6'-Disulfanediylbis(3-methylaniline), 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-[(2-amino-4-methylphenyl)disulfanyl]-5-methylaniline (CAS 22261-57-0) is a chemical compound with the molecular formula C14H16N2S2 and a molecular weight of 276.4 g/mol. IUPAC name: 2-[(2-amino-4-methylphenyl)disulfanyl]-5-methylaniline. InChIKey: WLVKUHMLYPMLJY-UHFFFAOYSA-N.
| Molecular formula | C14H16N2S2 |
|---|---|
| Molecular weight | 276.4 g/mol |
| IUPAC name | 2-[(2-amino-4-methylphenyl)disulfanyl]-5-methylaniline |
| InChIKey | WLVKUHMLYPMLJY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)SSC2=C(C=C(C=C2)C)N)N |
Computed by PubChem (NCBI)