Products 2226183-50-0
CAS 2226183-50-0 is the registry number for N3-DABu-Suc-OH. Offered by: Iris Biotech. Available pack sizes: 250mg, 500mg, 1g, 5g, 25g.
4-(4-azidobutylamino)-4-oxobutanoic acid (CAS 2226183-50-0) is a chemical compound with the molecular formula C8H14N4O3 and a molecular weight of 214.22 g/mol. IUPAC name: 4-(4-azidobutylamino)-4-oxobutanoic acid. InChIKey: YBLZBERTCLHFTG-UHFFFAOYSA-N.
| Molecular formula | C8H14N4O3 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 4-(4-azidobutylamino)-4-oxobutanoic acid |
| InChIKey | YBLZBERTCLHFTG-UHFFFAOYSA-N |
| SMILES | C(CCN=[N+]=[N-])CNC(=O)CCC(=O)O |
Computed by PubChem (NCBI)