Products 2226299-83-6

CAS 2226299-83-6 is the registry number for 2-((5-(Benzyloxy)pentyl)oxy)ethyl 4-methylbenzenesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(5-phenylmethoxypentoxy)ethyl 4-methylbenzenesulfonate (CAS 2226299-83-6) is a chemical compound with the molecular formula C21H28O5S and a molecular weight of 392.5 g/mol. IUPAC name: 2-(5-phenylmethoxypentoxy)ethyl 4-methylbenzenesulfonate. InChIKey: VWHNNLSBCVUGEA-UHFFFAOYSA-N.

Identity
Molecular formulaC21H28O5S
Molecular weight392.5 g/mol
IUPAC name2-(5-phenylmethoxypentoxy)ethyl 4-methylbenzenesulfonate
InChIKeyVWHNNLSBCVUGEA-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OCCOCCCCCOCC2=CC=CC=C2

Computed by PubChem (NCBI)