CAS 2226507-04-4 appears in our catalog under these names: BDP9066, BDP9066, 98%, BDP9066/ 98.18% (existing batch purity), BPD 9066, BDP9066, 98.49%. Offered by: Chemat Brand, AmBeed, TargetMol, Biosynth, Chemat. Available pack sizes: on request, 1g, 100mg, 1mg, 5mg, 10mg, 25mg, 50mg.
(6S)-8-(3-pyrimidin-4-yl-1H-pyrrolo[2,3-b]pyridin-4-yl)-1,8-diazaspiro[5.5]undecane (CAS 2226507-04-4) is a chemical compound with the molecular formula C20H24N6 and a molecular weight of 348.4 g/mol. IUPAC name: (6S)-8-(3-pyrimidin-4-yl-1H-pyrrolo[2,3-b]pyridin-4-yl)-1,8-diazaspiro[5.5]undecane. InChIKey: UELSMLDRSQFVHG-FQEVSTJZSA-N.
| Molecular formula | C20H24N6 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | (6S)-8-(3-pyrimidin-4-yl-1H-pyrrolo[2,3-b]pyridin-4-yl)-1,8-diazaspiro[5.5]undecane |
| InChIKey | UELSMLDRSQFVHG-FQEVSTJZSA-N |
| SMILES | C1CCN[C@@]2(C1)CCCN(C2)C3=C4C(=CNC4=NC=C3)C5=NC=NC=C5 |
Computed by PubChem (NCBI)