Products 2226507-05-5
CAS 2226507-05-5 is the registry number for BDP8900. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-[(6S)-1,8-diazaspiro[5.5]undecan-8-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-1,3-thiazole (CAS 2226507-05-5) is a chemical compound with the molecular formula C19H23N5S and a molecular weight of 353.5 g/mol. IUPAC name: 2-[4-[(6S)-1,8-diazaspiro[5.5]undecan-8-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-1,3-thiazole. InChIKey: AZYKATVQZWSITP-IBGZPJMESA-N.
| Molecular formula | C19H23N5S |
|---|---|
| Molecular weight | 353.5 g/mol |
| IUPAC name | 2-[4-[(6S)-1,8-diazaspiro[5.5]undecan-8-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-1,3-thiazole |
| InChIKey | AZYKATVQZWSITP-IBGZPJMESA-N |
| SMILES | C1CCN[C@@]2(C1)CCCN(C2)C3=C4C(=CNC4=NC=C3)C5=NC=CS5 |
Computed by PubChem (NCBI)
Synonyms:
orb1739711, AQE