CAS 2227035-18-7 is the registry number for 3-(2-Bromo-1-fluoroethenyl)-2,4-dichloro-1,5-dimethoxybenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g.
3-[(Z)-2-bromo-1-fluoroethenyl]-2,4-dichloro-1,5-dimethoxybenzene (CAS 2227035-18-7) is a chemical compound with the molecular formula C10H8BrCl2FO2 and a molecular weight of 329.97 g/mol. IUPAC name: 3-[(Z)-2-bromo-1-fluoroethenyl]-2,4-dichloro-1,5-dimethoxybenzene. InChIKey: UMYYWVPCTMWRRD-PLNGDYQASA-N.
| Molecular formula | C10H8BrCl2FO2 |
|---|---|
| Molecular weight | 329.97 g/mol |
| IUPAC name | 3-[(Z)-2-bromo-1-fluoroethenyl]-2,4-dichloro-1,5-dimethoxybenzene |
| InChIKey | UMYYWVPCTMWRRD-PLNGDYQASA-N |
| SMILES | COC1=CC(=C(C(=C1Cl)/C(=C/Br)/F)Cl)OC |
Computed by PubChem (NCBI)