CAS 2227103-37-7 appears in our catalog under these names: Osimertinib Impurity 14, N'-Desacryloyl N'-acetyl Osimertinib, Rezivertinib analogue 1, Rezivertinib analogue 1, Rezivertinib analogue 1 99%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Ambeed. Available pack sizes: on request, 1g, 2mg, 10mg, 100mg, 25mg, 5mg, 10mM (in 1ml dmso).
N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]acetamide (CAS 2227103-37-7) is a chemical compound with the molecular formula C27H33N7O2 and a molecular weight of 487.6 g/mol. IUPAC name: N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]acetamide. InChIKey: FZPRMSLRRIEUNO-UHFFFAOYSA-N.
| Molecular formula | C27H33N7O2 |
|---|---|
| Molecular weight | 487.6 g/mol |
| IUPAC name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]acetamide |
| InChIKey | FZPRMSLRRIEUNO-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1N(C)CCN(C)C)OC)NC2=NC=CC(=N2)C3=CN(C4=CC=CC=C43)C |
Computed by PubChem (NCBI)