Products 2227126-09-0

CAS 2227126-09-0 is the registry number for 2-Bromo-5-(4-cyanophenoxy)benzyl acetate, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

[2-bromo-5-(4-cyanophenoxy)phenyl]methyl acetate (CAS 2227126-09-0) is a chemical compound with the molecular formula C16H12BrNO3 and a molecular weight of 346.17 g/mol. IUPAC name: [2-bromo-5-(4-cyanophenoxy)phenyl]methyl acetate. InChIKey: LESJMARECHWSBI-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12BrNO3
Molecular weight346.17 g/mol
IUPAC name[2-bromo-5-(4-cyanophenoxy)phenyl]methyl acetate
InChIKeyLESJMARECHWSBI-UHFFFAOYSA-N
SMILESCC(=O)OCC1=C(C=CC(=C1)OC2=CC=C(C=C2)C#N)Br

Computed by PubChem (NCBI)