CAS 2227126-09-0 is the registry number for 2-Bromo-5-(4-cyanophenoxy)benzyl acetate, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[2-bromo-5-(4-cyanophenoxy)phenyl]methyl acetate (CAS 2227126-09-0) is a chemical compound with the molecular formula C16H12BrNO3 and a molecular weight of 346.17 g/mol. IUPAC name: [2-bromo-5-(4-cyanophenoxy)phenyl]methyl acetate. InChIKey: LESJMARECHWSBI-UHFFFAOYSA-N.
| Molecular formula | C16H12BrNO3 |
|---|---|
| Molecular weight | 346.17 g/mol |
| IUPAC name | [2-bromo-5-(4-cyanophenoxy)phenyl]methyl acetate |
| InChIKey | LESJMARECHWSBI-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1=C(C=CC(=C1)OC2=CC=C(C=C2)C#N)Br |
Computed by PubChem (NCBI)