Products 2227197-91-1

CAS 2227197-91-1 is the registry number for (1R,2S)-2-Methoxycyclobutan-1-amine hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Cis-(1R,2S)-2-methoxycyclobutan-1-amine;hydrochloride (CAS 2227197-91-1) is a chemical compound with the molecular formula C5H12ClNO and a molecular weight of 137.61 g/mol. IUPAC name: cis-(1R,2S)-2-methoxycyclobutan-1-amine;hydrochloride. InChIKey: ZVONGBUZWDPLLF-JBUOLDKXSA-N.

Identity
Molecular formulaC5H12ClNO
Molecular weight137.61 g/mol
IUPAC namecis-(1R,2S)-2-methoxycyclobutan-1-amine;hydrochloride
InChIKeyZVONGBUZWDPLLF-JBUOLDKXSA-N
SMILESCO[C@H]1CC[C@H]1N.Cl

Computed by PubChem (NCBI)