CAS 2227198-47-0 is the registry number for tert-Butyl N-((1R,4S,6R)-2-azabicyclo(2.2.1)heptan-6-yl)carbamate, 97%. Offered by: AmBeed. Available pack sizes: 1g, 250mg, 100mg.
Tert-butyl N-[(1R,4S,6R)-2-azabicyclo[2.2.1]heptan-6-yl]carbamate (CAS 2227198-47-0) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl N-[(1R,4S,6R)-2-azabicyclo[2.2.1]heptan-6-yl]carbamate. InChIKey: JFEPYXAQPBPXRI-DJLDLDEBSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl N-[(1R,4S,6R)-2-azabicyclo[2.2.1]heptan-6-yl]carbamate |
| InChIKey | JFEPYXAQPBPXRI-DJLDLDEBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@@H]2C[C@H]1NC2 |
Computed by PubChem (NCBI)