CAS 2227198-61-8 is the registry number for (3R,5S)-5-Aminotetrahydro-2H-pyran-3-ol hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(3R,5S)-5-aminooxan-3-ol;hydrochloride (CAS 2227198-61-8) is a chemical compound with the molecular formula C5H12ClNO2 and a molecular weight of 153.61 g/mol. IUPAC name: (3R,5S)-5-aminooxan-3-ol;hydrochloride. InChIKey: XAVXIXWOZUSCNX-UYXJWNHNSA-N.
| Molecular formula | C5H12ClNO2 |
|---|---|
| Molecular weight | 153.61 g/mol |
| IUPAC name | (3R,5S)-5-aminooxan-3-ol;hydrochloride |
| InChIKey | XAVXIXWOZUSCNX-UYXJWNHNSA-N |
| SMILES | C1[C@@H](COC[C@@H]1O)N.Cl |
Computed by PubChem (NCBI)