Products 2227199-14-4
CAS 2227199-14-4 appears in our catalog under these names: (2S,3S)-2,3-Bis (benzoyloxy)-4-(isopropylamino)-4-oxobutanoic acid, 97%, 97%, (2S,3S)-2,3-Bis(benzoyloxy)-3-[(propan-2-yl)carbamoyl]propanoic acid, 97%, (2S,3S)-2,3-bis(benzoyloxy)-3-((propan-2-yl)carbamoyl)propanoic acid, 97%. Offered by: Chemat, Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 100g, 1g, 25g, 10g, 5g.
(2S,3S)-2,3-dibenzoyloxy-4-oxo-4-(propan-2-ylamino)butanoic acid (CAS 2227199-14-4) is a chemical compound with the molecular formula C21H21NO7 and a molecular weight of 399.4 g/mol. IUPAC name: (2S,3S)-2,3-dibenzoyloxy-4-oxo-4-(propan-2-ylamino)butanoic acid. InChIKey: YUZORMGPDNJKHY-IRXDYDNUSA-N.
| Molecular formula | C21H21NO7 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | (2S,3S)-2,3-dibenzoyloxy-4-oxo-4-(propan-2-ylamino)butanoic acid |
| InChIKey | YUZORMGPDNJKHY-IRXDYDNUSA-N |
| SMILES | CC(C)NC(=O)[C@H]([C@@H](C(=O)O)OC(=O)C1=CC=CC=C1)OC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)