CAS 2227206-21-3 is the registry number for Methyl 1'-tosylspiro[cyclohexane-1,3'-indoline]-5'-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 1-(4-methylphenyl)sulfonylspiro[2H-indole-3,1'-cyclohexane]-5-carboxylate (CAS 2227206-21-3) is a chemical compound with the molecular formula C22H25NO4S and a molecular weight of 399.5 g/mol. IUPAC name: methyl 1-(4-methylphenyl)sulfonylspiro[2H-indole-3,1'-cyclohexane]-5-carboxylate. InChIKey: KNXQXYLIQZYEHZ-UHFFFAOYSA-N.
| Molecular formula | C22H25NO4S |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | methyl 1-(4-methylphenyl)sulfonylspiro[2H-indole-3,1'-cyclohexane]-5-carboxylate |
| InChIKey | KNXQXYLIQZYEHZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC3(CCCCC3)C4=C2C=CC(=C4)C(=O)OC |
Computed by PubChem (NCBI)