Products 2227206-37-1

CAS 2227206-37-1 is the registry number for 5-Methyl-8-oxa-2,5-diaza-spiro[3.5]nonan-6-one hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

5-methyl-8-oxa-2,5-diazaspiro[3.5]nonan-6-one;hydrochloride (CAS 2227206-37-1) is a chemical compound with the molecular formula C7H13ClN2O2 and a molecular weight of 192.64 g/mol. IUPAC name: 5-methyl-8-oxa-2,5-diazaspiro[3.5]nonan-6-one;hydrochloride. InChIKey: FABLOKZMNLDWMF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13ClN2O2
Molecular weight192.64 g/mol
IUPAC name5-methyl-8-oxa-2,5-diazaspiro[3.5]nonan-6-one;hydrochloride
InChIKeyFABLOKZMNLDWMF-UHFFFAOYSA-N
SMILESCN1C(=O)COCC12CNC2.Cl

Computed by PubChem (NCBI)