CAS 2227272-53-7 is the registry number for 2-(2-Bromoethynyl)-1-chloro-3-fluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
2-(2-bromoethynyl)-1-chloro-3-fluorobenzene (CAS 2227272-53-7) is a chemical compound with the molecular formula C8H3BrClF and a molecular weight of 233.46 g/mol. IUPAC name: 2-(2-bromoethynyl)-1-chloro-3-fluorobenzene. InChIKey: GWDBFTHIYSHYLR-UHFFFAOYSA-N.
| Molecular formula | C8H3BrClF |
|---|---|
| Molecular weight | 233.46 g/mol |
| IUPAC name | 2-(2-bromoethynyl)-1-chloro-3-fluorobenzene |
| InChIKey | GWDBFTHIYSHYLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C#CBr)F |
Computed by PubChem (NCBI)