CAS 2227272-84-4 is the registry number for 1-Bromo-3-(2,2-dibromovinyl)-5-isopropylbenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
1-bromo-3-(2,2-dibromoethenyl)-5-propan-2-ylbenzene (CAS 2227272-84-4) is a chemical compound with the molecular formula C11H11Br3 and a molecular weight of 382.92 g/mol. IUPAC name: 1-bromo-3-(2,2-dibromoethenyl)-5-propan-2-ylbenzene. InChIKey: DTCIVDUCTXKACF-UHFFFAOYSA-N.
| Molecular formula | C11H11Br3 |
|---|---|
| Molecular weight | 382.92 g/mol |
| IUPAC name | 1-bromo-3-(2,2-dibromoethenyl)-5-propan-2-ylbenzene |
| InChIKey | DTCIVDUCTXKACF-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1)C=C(Br)Br)Br |
Computed by PubChem (NCBI)