CAS 2227272-86-6 is the registry number for 6-Iodo-8-phenylimidazo[1,2-a]pyrazine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
6-iodo-8-phenylimidazo[1,2-a]pyrazine (CAS 2227272-86-6) is a chemical compound with the molecular formula C12H8IN3 and a molecular weight of 321.12 g/mol. IUPAC name: 6-iodo-8-phenylimidazo[1,2-a]pyrazine. InChIKey: OHYIYYSBSHTMBH-UHFFFAOYSA-N.
| Molecular formula | C12H8IN3 |
|---|---|
| Molecular weight | 321.12 g/mol |
| IUPAC name | 6-iodo-8-phenylimidazo[1,2-a]pyrazine |
| InChIKey | OHYIYYSBSHTMBH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CN3C2=NC=C3)I |
Computed by PubChem (NCBI)