CAS 2227279-84-5 appears in our catalog under these names: GSK–3 inhibitor 3, GSK-3 inhibitor 3, 98%, GSK-3 inhibitor 3/ 98.36% (existing batch purity), GSK-3 inhibitor 3 98%, GSK-3 inhibitor 3. Offered by: GLPBio, AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 100mg, 1mg, 10mg, 25mg, 50mg, 500mg, 10 mg.
2-(4-cyanoanilino)-N-[4-(4-fluorophenyl)-3-pyridinyl]pyrimidine-4-carboxamide (CAS 2227279-84-5) is a chemical compound with the molecular formula C23H15FN6O and a molecular weight of 410.4 g/mol. IUPAC name: 2-(4-cyanoanilino)-N-[4-(4-fluorophenyl)-3-pyridinyl]pyrimidine-4-carboxamide. InChIKey: QLWFPXXGZGCHFQ-UHFFFAOYSA-N.
| Molecular formula | C23H15FN6O |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | 2-(4-cyanoanilino)-N-[4-(4-fluorophenyl)-3-pyridinyl]pyrimidine-4-carboxamide |
| InChIKey | QLWFPXXGZGCHFQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)NC2=NC=CC(=N2)C(=O)NC3=C(C=CN=C3)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)