Products 2227449-70-7

CAS 2227449-70-7 is the registry number for Bac-429. Offered by: MedChemExpress. Available pack sizes: 1 mg, 25 mg, 10 mg, 100 mg, 5 mg.

Structural formula: {0} (CAS {1})

(2S)-2-[[(Z)-octadec-11-enoyl]amino]-3-phenylpropanoic acid (CAS 2227449-70-7) is a chemical compound with the molecular formula C27H43NO3 and a molecular weight of 429.6 g/mol. IUPAC name: (2S)-2-[[(Z)-octadec-11-enoyl]amino]-3-phenylpropanoic acid. InChIKey: JABNLHORSJFXJN-UTBBOMKLSA-N.

Identity
Molecular formulaC27H43NO3
Molecular weight429.6 g/mol
IUPAC name(2S)-2-[[(Z)-octadec-11-enoyl]amino]-3-phenylpropanoic acid
InChIKeyJABNLHORSJFXJN-UTBBOMKLSA-N
SMILESCCCCCC/C=C\CCCCCCCCCC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O

Computed by PubChem (NCBI)

Synonyms: Bac-429, orb2695178