CAS 2227641-27-0 appears in our catalog under these names: (S)-1-(2-Chloropyridin-3-yl)ethan-1-ol, 98%, (S)-1-(2-Chloropyridin-3-yl)ethan-1-ol, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg, 5g, 10g.
(1S)-1-(2-chloro-3-pyridinyl)ethanol (CAS 2227641-27-0) is a chemical compound with the molecular formula C7H8ClNO and a molecular weight of 157.60 g/mol. IUPAC name: (1S)-1-(2-chloro-3-pyridinyl)ethanol. InChIKey: FVMGQROBOUHKQO-YFKPBYRVSA-N.
| Molecular formula | C7H8ClNO |
|---|---|
| Molecular weight | 157.60 g/mol |
| IUPAC name | (1S)-1-(2-chloro-3-pyridinyl)ethanol |
| InChIKey | FVMGQROBOUHKQO-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=C(N=CC=C1)Cl)O |
Computed by PubChem (NCBI)