CAS 2227643-74-3 is the registry number for (R)-1-(2,5-Dibromopyridin-3-yl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(2,5-dibromo-3-pyridinyl)ethanol (CAS 2227643-74-3) is a chemical compound with the molecular formula C7H7Br2NO and a molecular weight of 280.94 g/mol. IUPAC name: (1R)-1-(2,5-dibromo-3-pyridinyl)ethanol. InChIKey: JBPPNWPKVSTGGE-SCSAIBSYSA-N.
| Molecular formula | C7H7Br2NO |
|---|---|
| Molecular weight | 280.94 g/mol |
| IUPAC name | (1R)-1-(2,5-dibromo-3-pyridinyl)ethanol |
| InChIKey | JBPPNWPKVSTGGE-SCSAIBSYSA-N |
| SMILES | C[C@H](C1=C(N=CC(=C1)Br)Br)O |
Computed by PubChem (NCBI)