Products 2227679-48-1
CAS 2227679-48-1 is the registry number for 2-((3R,4S)-4-Hydroxypyrrolidin-3-yl)acetonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3R,4S)-4-hydroxypyrrolidin-3-yl]acetonitrile (CAS 2227679-48-1) is a chemical compound with the molecular formula C6H10N2O and a molecular weight of 126.16 g/mol. IUPAC name: 2-[(3R,4S)-4-hydroxypyrrolidin-3-yl]acetonitrile. InChIKey: MSGNFTQKFKQAHU-PHDIDXHHSA-N.
| Molecular formula | C6H10N2O |
|---|---|
| Molecular weight | 126.16 g/mol |
| IUPAC name | 2-[(3R,4S)-4-hydroxypyrrolidin-3-yl]acetonitrile |
| InChIKey | MSGNFTQKFKQAHU-PHDIDXHHSA-N |
| SMILES | C1[C@H]([C@@H](CN1)O)CC#N |
Computed by PubChem (NCBI)