CAS 2227707-58-4 is the registry number for (2S)-1-(3,4-Dihydro-1H-2-benzopyran-6-yl)propan-2-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2S)-1-(3,4-dihydro-1H-isochromen-6-yl)propan-2-amine (CAS 2227707-58-4) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. IUPAC name: (2S)-1-(3,4-dihydro-1H-isochromen-6-yl)propan-2-amine. InChIKey: ZLQYOPFUKLGGHE-VIFPVBQESA-N.
| Molecular formula | C12H17NO |
|---|---|
| Molecular weight | 191.27 g/mol |
| IUPAC name | (2S)-1-(3,4-dihydro-1H-isochromen-6-yl)propan-2-amine |
| InChIKey | ZLQYOPFUKLGGHE-VIFPVBQESA-N |
| SMILES | C[C@@H](CC1=CC2=C(COCC2)C=C1)N |
Computed by PubChem (NCBI)