CAS 2227755-27-1 appears in our catalog under these names: trans–2–(2–fluoro–5–nitrophenyl)cyclopropane–1–carboxylic acid, rac-(1R,2R)-2-(2-fluoro-5-nitrophenyl)cyclopropane-1-carboxylic acid. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 500mg, 5g.
Trans-(1R,2R)-2-(2-fluoro-5-nitrophenyl)cyclopropane-1-carboxylic acid (CAS 2227755-27-1) is a chemical compound with the molecular formula C10H8FNO4 and a molecular weight of 225.17 g/mol. IUPAC name: trans-(1R,2R)-2-(2-fluoro-5-nitrophenyl)cyclopropane-1-carboxylic acid. InChIKey: FSRBAVSPEDPDMK-POYBYMJQSA-N.
| Molecular formula | C10H8FNO4 |
|---|---|
| Molecular weight | 225.17 g/mol |
| IUPAC name | trans-(1R,2R)-2-(2-fluoro-5-nitrophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | FSRBAVSPEDPDMK-POYBYMJQSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=C(C=CC(=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)