Products 2227763-91-7
CAS 2227763-91-7 is the registry number for rac-(4aR,8aS)-6-Ethyl-octahydro-2H-pyrido(4,3-b)morpholine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4aR,8aS)-6-ethyl-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazine (CAS 2227763-91-7) is a chemical compound with the molecular formula C9H18N2O and a molecular weight of 170.25 g/mol. IUPAC name: (4aR,8aS)-6-ethyl-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazine. InChIKey: QCXAZFGAIOFYNS-BDAKNGLRSA-N.
| Molecular formula | C9H18N2O |
|---|---|
| Molecular weight | 170.25 g/mol |
| IUPAC name | (4aR,8aS)-6-ethyl-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazine |
| InChIKey | QCXAZFGAIOFYNS-BDAKNGLRSA-N |
| SMILES | CCN1CC[C@H]2[C@@H](C1)NCCO2 |
Computed by PubChem (NCBI)