CAS 2228022-16-8 is the registry number for rac-(1R,5R)-6-Methoxybicyclo(3.2.0)heptane-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,25g, 25mg.
(1S,5S)-6-methoxybicyclo[3.2.0]heptane-3-carboxylic acid (CAS 2228022-16-8) is a chemical compound with the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. IUPAC name: (1S,5S)-6-methoxybicyclo[3.2.0]heptane-3-carboxylic acid. InChIKey: ZYUSJOFZLGFEMK-DNBGNTRDSA-N.
| Molecular formula | C9H14O3 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | (1S,5S)-6-methoxybicyclo[3.2.0]heptane-3-carboxylic acid |
| InChIKey | ZYUSJOFZLGFEMK-DNBGNTRDSA-N |
| SMILES | COC1C[C@H]2[C@@H]1CC(C2)C(=O)O |
Computed by PubChem (NCBI)