CAS 2228155-76-6 appears in our catalog under these names: potassium (dimethyl-1,2,4-triazin-3-yl)sulfanide, 95%, Potassium 5,6-dimethyl-1,2,4-triazine-3-thiolate, 98%, Potassium (dimethyl-1,2,4-triazin-3-yl)sulfanide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
Potassium 5,6-dimethyl-1,2,4-triazine-3-thiolate (CAS 2228155-76-6) is a chemical compound with the molecular formula C5H6KN3S and a molecular weight of 179.29 g/mol. IUPAC name: potassium 5,6-dimethyl-1,2,4-triazine-3-thiolate. InChIKey: UKECHALKYHKELW-UHFFFAOYSA-M.
| Molecular formula | C5H6KN3S |
|---|---|
| Molecular weight | 179.29 g/mol |
| IUPAC name | potassium 5,6-dimethyl-1,2,4-triazine-3-thiolate |
| InChIKey | UKECHALKYHKELW-UHFFFAOYSA-M |
| SMILES | CC1=C(N=NC(=N1)[S-])C.[K+] |
Computed by PubChem (NCBI)