Products 2228179-60-8

CAS 2228179-60-8 is the registry number for 5,5-Dioxo-4H,6H-5λâ¶-thieno(3,4-b)furan-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5,5-dioxo-4,6-dihydrothieno[3,4-b]furan-3-carboxylic acid (CAS 2228179-60-8) is a chemical compound with the molecular formula C7H6O5S and a molecular weight of 202.19 g/mol. IUPAC name: 5,5-dioxo-4,6-dihydrothieno[3,4-b]furan-3-carboxylic acid. InChIKey: VTTXUTRJEGANSL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6O5S
Molecular weight202.19 g/mol
IUPAC name5,5-dioxo-4,6-dihydrothieno[3,4-b]furan-3-carboxylic acid
InChIKeyVTTXUTRJEGANSL-UHFFFAOYSA-N
SMILESC1C2=C(CS1(=O)=O)OC=C2C(=O)O

Computed by PubChem (NCBI)