CAS 2228179-60-8 is the registry number for 5,5-Dioxo-4H,6H-5λâ¶-thieno(3,4-b)furan-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5,5-dioxo-4,6-dihydrothieno[3,4-b]furan-3-carboxylic acid (CAS 2228179-60-8) is a chemical compound with the molecular formula C7H6O5S and a molecular weight of 202.19 g/mol. IUPAC name: 5,5-dioxo-4,6-dihydrothieno[3,4-b]furan-3-carboxylic acid. InChIKey: VTTXUTRJEGANSL-UHFFFAOYSA-N.
| Molecular formula | C7H6O5S |
|---|---|
| Molecular weight | 202.19 g/mol |
| IUPAC name | 5,5-dioxo-4,6-dihydrothieno[3,4-b]furan-3-carboxylic acid |
| InChIKey | VTTXUTRJEGANSL-UHFFFAOYSA-N |
| SMILES | C1C2=C(CS1(=O)=O)OC=C2C(=O)O |
Computed by PubChem (NCBI)