Products 2228293-17-0

CAS 2228293-17-0 is the registry number for 3-(2-Chloro-6-(trifluoromethyl)phenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[2-chloro-6-(trifluoromethyl)phenyl]-2-oxopropanoic acid (CAS 2228293-17-0) is a chemical compound with the molecular formula C10H6ClF3O3 and a molecular weight of 266.60 g/mol. IUPAC name: 3-[2-chloro-6-(trifluoromethyl)phenyl]-2-oxopropanoic acid. InChIKey: KBXIVFZEPIUUAJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6ClF3O3
Molecular weight266.60 g/mol
IUPAC name3-[2-chloro-6-(trifluoromethyl)phenyl]-2-oxopropanoic acid
InChIKeyKBXIVFZEPIUUAJ-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Cl)CC(=O)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)