CAS 2228305-67-5 is the registry number for tert-Butyl 3-(5-amino-1-methyl-1H-1,2,4-triazol-3-yl)piperidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 3-(5-amino-1-methyl-1,2,4-triazol-3-yl)piperidine-1-carboxylate (CAS 2228305-67-5) is a chemical compound with the molecular formula C13H23N5O2 and a molecular weight of 281.35 g/mol. IUPAC name: tert-butyl 3-(5-amino-1-methyl-1,2,4-triazol-3-yl)piperidine-1-carboxylate. InChIKey: RWHGKFTVXXIPOT-UHFFFAOYSA-N.
| Molecular formula | C13H23N5O2 |
|---|---|
| Molecular weight | 281.35 g/mol |
| IUPAC name | tert-butyl 3-(5-amino-1-methyl-1,2,4-triazol-3-yl)piperidine-1-carboxylate |
| InChIKey | RWHGKFTVXXIPOT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)C2=NN(C(=N2)N)C |
Computed by PubChem (NCBI)