CAS 222832-30-6 is the registry number for N-Descarbo(1,4-benzodioxine), N-Acetyl Doxazosin Hydrochloride. Offered by: TRC. Available pack sizes: 500mg.
1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]ethanone;hydrochloride (CAS 222832-30-6) is a chemical compound with the molecular formula C16H22ClN5O3 and a molecular weight of 367.8 g/mol. IUPAC name: 1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]ethanone;hydrochloride. InChIKey: SDFNLERNFVENIR-UHFFFAOYSA-N.
| Molecular formula | C16H22ClN5O3 |
|---|---|
| Molecular weight | 367.8 g/mol |
| IUPAC name | 1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]ethanone;hydrochloride |
| InChIKey | SDFNLERNFVENIR-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCN(CC1)C2=NC3=CC(=C(C=C3C(=N2)N)OC)OC.Cl |
Computed by PubChem (NCBI)