Products 2228355-78-8
CAS 2228355-78-8 is the registry number for 1-Amino-2-{6,6-dimethylbicyclo(3.1.1)hept-2-en-2-yl}propan-2-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-amino-2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)propan-2-ol (CAS 2228355-78-8) is a chemical compound with the molecular formula C12H21NO and a molecular weight of 195.30 g/mol. IUPAC name: 1-amino-2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)propan-2-ol. InChIKey: AQOUXANYKATMSM-UHFFFAOYSA-N.
| Molecular formula | C12H21NO |
|---|---|
| Molecular weight | 195.30 g/mol |
| IUPAC name | 1-amino-2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)propan-2-ol |
| InChIKey | AQOUXANYKATMSM-UHFFFAOYSA-N |
| SMILES | CC1(C2CC=C(C1C2)C(C)(CN)O)C |
Computed by PubChem (NCBI)