Products 222840-73-5

CAS 222840-73-5 is the registry number for 3-Hydroxymethylthiophene-2-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

[3-(hydroxymethyl)thiophen-2-yl]boronic acid (CAS 222840-73-5) is a chemical compound with the molecular formula C5H7BO3S and a molecular weight of 157.99 g/mol. IUPAC name: [3-(hydroxymethyl)thiophen-2-yl]boronic acid. InChIKey: HUUVNOIORZPHNG-UHFFFAOYSA-N.

Identity
Molecular formulaC5H7BO3S
Molecular weight157.99 g/mol
IUPAC name[3-(hydroxymethyl)thiophen-2-yl]boronic acid
InChIKeyHUUVNOIORZPHNG-UHFFFAOYSA-N
SMILESB(C1=C(C=CS1)CO)(O)O

Computed by PubChem (NCBI)