CAS 222840-93-9 is the registry number for 2,3-Dibromo-5-(4-ethoxycarbonylphenyl)thiophene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
Ethyl 4-(4,5-dibromothiophen-2-yl)benzoate (CAS 222840-93-9) is a chemical compound with the molecular formula C13H10Br2O2S and a molecular weight of 390.09 g/mol. IUPAC name: ethyl 4-(4,5-dibromothiophen-2-yl)benzoate. InChIKey: YKJFKGUWVYZXQB-UHFFFAOYSA-N.
| Molecular formula | C13H10Br2O2S |
|---|---|
| Molecular weight | 390.09 g/mol |
| IUPAC name | ethyl 4-(4,5-dibromothiophen-2-yl)benzoate |
| InChIKey | YKJFKGUWVYZXQB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C2=CC(=C(S2)Br)Br |
Computed by PubChem (NCBI)