Products 2228463-55-4

CAS 2228463-55-4 is the registry number for 3-Ethyloxetane-3-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-ethyloxetane-3-sulfonyl chloride (CAS 2228463-55-4) is a chemical compound with the molecular formula C5H9ClO3S and a molecular weight of 184.64 g/mol. IUPAC name: 3-ethyloxetane-3-sulfonyl chloride. InChIKey: HRLMFBAJCDWLET-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9ClO3S
Molecular weight184.64 g/mol
IUPAC name3-ethyloxetane-3-sulfonyl chloride
InChIKeyHRLMFBAJCDWLET-UHFFFAOYSA-N
SMILESCCC1(COC1)S(=O)(=O)Cl

Computed by PubChem (NCBI)