Products 2228588-48-3

CAS 2228588-48-3 is the registry number for 4-(1H-Pyrazol-4-yl)-1,2,3-thiadiazole, 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4-(1H-pyrazol-4-yl)thiadiazole (CAS 2228588-48-3) is a chemical compound with the molecular formula C5H4N4S and a molecular weight of 152.18 g/mol. IUPAC name: 4-(1H-pyrazol-4-yl)thiadiazole. InChIKey: GZCIUJKDKVRJJA-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4N4S
Molecular weight152.18 g/mol
IUPAC name4-(1H-pyrazol-4-yl)thiadiazole
InChIKeyGZCIUJKDKVRJJA-UHFFFAOYSA-N
SMILESC1=C(C=NN1)C2=CSN=N2

Computed by PubChem (NCBI)