Products 2228608-88-4

CAS 2228608-88-4 appears in our catalog under these names: 2,2–difluoro–2–(3–methoxypyridin–2–yl)ethan–1–ol, 2,2-Difluoro-2-(3-methoxypyridin-2-yl)ethan-1-ol. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 25mg.

Structural formula: {0} (CAS {1})

2,2-difluoro-2-(3-methoxy-2-pyridinyl)ethanol (CAS 2228608-88-4) is a chemical compound with the molecular formula C8H9F2NO2 and a molecular weight of 189.16 g/mol. IUPAC name: 2,2-difluoro-2-(3-methoxy-2-pyridinyl)ethanol. InChIKey: AUXMDPFQBJOFBG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9F2NO2
Molecular weight189.16 g/mol
IUPAC name2,2-difluoro-2-(3-methoxy-2-pyridinyl)ethanol
InChIKeyAUXMDPFQBJOFBG-UHFFFAOYSA-N
SMILESCOC1=C(N=CC=C1)C(CO)(F)F

Computed by PubChem (NCBI)