Products 2228664-35-3
CAS 2228664-35-3 is the registry number for tert-Butyl 1,5-dioxo-1,2,3,5-tetrahydroindolizine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 1,5-dioxo-2,3-dihydroindolizine-2-carboxylate (CAS 2228664-35-3) is a chemical compound with the molecular formula C13H15NO4 and a molecular weight of 249.26 g/mol. IUPAC name: tert-butyl 1,5-dioxo-2,3-dihydroindolizine-2-carboxylate. InChIKey: PBDLIKRVORAUSO-UHFFFAOYSA-N.
| Molecular formula | C13H15NO4 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | tert-butyl 1,5-dioxo-2,3-dihydroindolizine-2-carboxylate |
| InChIKey | PBDLIKRVORAUSO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CN2C(=O)C=CC=C2C1=O |
Computed by PubChem (NCBI)