CAS 2228703-86-2 is the registry number for 5-(2-Fluoropropan-2-yl)isoxazole-3-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
5-(2-fluoropropan-2-yl)-1,2-oxazole-3-carboxylic acid (CAS 2228703-86-2) is a chemical compound with the molecular formula C7H8FNO3 and a molecular weight of 173.14 g/mol. IUPAC name: 5-(2-fluoropropan-2-yl)-1,2-oxazole-3-carboxylic acid. InChIKey: CSLIOLHLHVVDCU-UHFFFAOYSA-N.
| Molecular formula | C7H8FNO3 |
|---|---|
| Molecular weight | 173.14 g/mol |
| IUPAC name | 5-(2-fluoropropan-2-yl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | CSLIOLHLHVVDCU-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=NO1)C(=O)O)F |
Computed by PubChem (NCBI)