Products 2228792-35-4
CAS 2228792-35-4 is the registry number for 1-(4-Chloro-2-nitrophenyl)-2,2,2-trifluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
1-(4-chloro-2-nitrophenyl)-2,2,2-trifluoroethanone (CAS 2228792-35-4) is a chemical compound with the molecular formula C8H3ClF3NO3 and a molecular weight of 253.56 g/mol. IUPAC name: 1-(4-chloro-2-nitrophenyl)-2,2,2-trifluoroethanone. InChIKey: JTFBLZJVUYQJQE-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NO3 |
|---|---|
| Molecular weight | 253.56 g/mol |
| IUPAC name | 1-(4-chloro-2-nitrophenyl)-2,2,2-trifluoroethanone |
| InChIKey | JTFBLZJVUYQJQE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)[N+](=O)[O-])C(=O)C(F)(F)F |
Computed by PubChem (NCBI)