CAS 2228857-32-5 appears in our catalog under these names: Azidoethyl-ss-propionic acid, 95%, Azidoethyl–SS–propionic acid, Azido-SS-COOH, 3-((2-Azidoethyl)disulfaneyl)propanoic acid, 96%, 96%, Azidoethyl-SS-propionic acid. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 500mg, Get quote.
3-(2-azidoethyldisulfanyl)propanoic acid (CAS 2228857-32-5) is a chemical compound with the molecular formula C5H9N3O2S2 and a molecular weight of 207.3 g/mol. IUPAC name: 3-(2-azidoethyldisulfanyl)propanoic acid. InChIKey: MIOCIBNCOQTVOB-UHFFFAOYSA-N.
| Molecular formula | C5H9N3O2S2 |
|---|---|
| Molecular weight | 207.3 g/mol |
| IUPAC name | 3-(2-azidoethyldisulfanyl)propanoic acid |
| InChIKey | MIOCIBNCOQTVOB-UHFFFAOYSA-N |
| SMILES | C(CSSCCN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)