Products 2228857-34-7
CAS 2228857-34-7 appears in our catalog under these names: Dbco-peg1-nhs ester, 95%, DBCO-PEG1-NHS ester, DBCO–PEG1–NHS ester, DBCO-PEG1-NHS ester 98%, DBCO-PEG1-NHS ester, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 2mg, 25mg, 50mg, 250mg, 1g, 50 mg, 25 mg.
(2,5-dioxopyrrolidin-1-yl) 3-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]propanoate (CAS 2228857-34-7) is a chemical compound with the molecular formula C28H27N3O7 and a molecular weight of 517.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]propanoate. InChIKey: TYDZSBPFYBWRTP-UHFFFAOYSA-N.
| Molecular formula | C28H27N3O7 |
|---|---|
| Molecular weight | 517.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]propanoate |
| InChIKey | TYDZSBPFYBWRTP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCNC(=O)CCC(=O)N2CC3=CC=CC=C3C#CC4=CC=CC=C42 |
Computed by PubChem (NCBI)