Products 2228932-03-2
CAS 2228932-03-2 appears in our catalog under these names: 1-(1-Ethynylcyclopropyl)-4-methoxybenzene, 95-<97%, 1-(1-Ethynylcyclopropyl)-4-methoxybenzene. Offered by: Hoffman Fine Chemicals, Biosynth. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g, 0,5g, 50mg.
1-(1-ethynylcyclopropyl)-4-methoxybenzene (CAS 2228932-03-2) is a chemical compound with the molecular formula C12H12O and a molecular weight of 172.22 g/mol. IUPAC name: 1-(1-ethynylcyclopropyl)-4-methoxybenzene. InChIKey: MLOIHNURQHFKOF-UHFFFAOYSA-N.
| Molecular formula | C12H12O |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | 1-(1-ethynylcyclopropyl)-4-methoxybenzene |
| InChIKey | MLOIHNURQHFKOF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2(CC2)C#C |
Computed by PubChem (NCBI)