CAS 2229218-26-0 is the registry number for 3-Methoxy-4-trifluoromethylbenzenecarbothiamide. Offered by: TRC. Available pack sizes: 500mg.
3-methoxy-4-(trifluoromethyl)benzenecarbothioamide (CAS 2229218-26-0) is a chemical compound with the molecular formula C9H8F3NOS and a molecular weight of 235.23 g/mol. IUPAC name: 3-methoxy-4-(trifluoromethyl)benzenecarbothioamide. InChIKey: OBSRJRVKEUKIJC-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NOS |
|---|---|
| Molecular weight | 235.23 g/mol |
| IUPAC name | 3-methoxy-4-(trifluoromethyl)benzenecarbothioamide |
| InChIKey | OBSRJRVKEUKIJC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=S)N)C(F)(F)F |
Computed by PubChem (NCBI)