CAS 2229310-84-1 is the registry number for 3-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)pyridine-4-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(9H-fluoren-9-ylmethoxycarbonylamino)pyridine-4-carboxylic acid;hydrochloride (CAS 2229310-84-1) is a chemical compound with the molecular formula C21H17ClN2O4 and a molecular weight of 396.8 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)pyridine-4-carboxylic acid;hydrochloride. InChIKey: OKNMZLGYFHVSMF-UHFFFAOYSA-N.
| Molecular formula | C21H17ClN2O4 |
|---|---|
| Molecular weight | 396.8 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)pyridine-4-carboxylic acid;hydrochloride |
| InChIKey | OKNMZLGYFHVSMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=C(C=CN=C4)C(=O)O.Cl |
Computed by PubChem (NCBI)