CAS 2229318-51-6 appears in our catalog under these names: 7-Oxa-2,5-diazaspiro(3.4)octan-6-one 2,2,2-trifluoroacetate, 98%, 7-oxa-2,5-diazaspiro[3.4]octan-6-one, trifluoroacetic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
7-oxa-2,5-diazaspiro[3.4]octan-6-one;2,2,2-trifluoroacetic acid (CAS 2229318-51-6) is a chemical compound with the molecular formula C7H9F3N2O4 and a molecular weight of 242.15 g/mol. IUPAC name: 7-oxa-2,5-diazaspiro[3.4]octan-6-one;2,2,2-trifluoroacetic acid. InChIKey: UUTDHPYFCHQCGU-UHFFFAOYSA-N.
| Molecular formula | C7H9F3N2O4 |
|---|---|
| Molecular weight | 242.15 g/mol |
| IUPAC name | 7-oxa-2,5-diazaspiro[3.4]octan-6-one;2,2,2-trifluoroacetic acid |
| InChIKey | UUTDHPYFCHQCGU-UHFFFAOYSA-N |
| SMILES | C1C2(CN1)COC(=O)N2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)