Products 2229409-91-8
CAS 2229409-91-8 appears in our catalog under these names: 2-Chloro-4-ethynyl-1-(trifluoromethyl)benzene, 95%, 2-Chloro-4-ethynyl-1-(trifluoromethyl)benzene. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-chloro-4-ethynyl-1-(trifluoromethyl)benzene (CAS 2229409-91-8) is a chemical compound with the molecular formula C9H4ClF3 and a molecular weight of 204.57 g/mol. IUPAC name: 2-chloro-4-ethynyl-1-(trifluoromethyl)benzene. InChIKey: DPRYFQVFAHHWFS-UHFFFAOYSA-N.
| Molecular formula | C9H4ClF3 |
|---|---|
| Molecular weight | 204.57 g/mol |
| IUPAC name | 2-chloro-4-ethynyl-1-(trifluoromethyl)benzene |
| InChIKey | DPRYFQVFAHHWFS-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=C(C=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)